C11H7F4N3O2S — CID 162653888
2-[4-[(2,3,5,6-tetrafluorophenyl)sulfanylmethyl]triazol-1-yl]acetic acid (PubChem CID 162653888) has the molecular formula C11H7F4N3O2S and a molecular weight of 321.26 g/mol. Its IUPAC name is 2-[4-[(2,3,5,6-tetrafluorophenyl)sulfanylmethyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[(2,3,5,6-tetrafluorophenyl)sulfanylmethyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 162653888 |
| Molecular Formula | C11H7F4N3O2S |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 2-[4-[(2,3,5,6-tetrafluorophenyl)sulfanylmethyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CSc2c(F)c(F)cc(F)c2F)nn1 |
| InChI | InChI=1S/C11H7F4N3O2S/c12-6-1-7(13)10(15)11(9(6)14)21-4-5-2-18(17-16-5)3-8(19)20/h1-2H,3-4H2,(H,19,20) |
| InChIKey | NQNATBDPGMYSIU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|