C35H53ClO6 — CID 162654415
[(1Z,4R,7R,9R,10R,15R,16R)-10,16-diacetyloxy-2-benzyl-1-chloro-7,9,15-trimethylnonadeca-1,18-dien-4-yl] acetate (PubChem CID 162654415) has the molecular formula C35H53ClO6 and a molecular weight of 605.26 g/mol. Its IUPAC name is [(1Z,4R,7R,9R,10R,15R,16R)-10,16-diacetyloxy-2-benzyl-1-chloro-7,9,15-trimethylnonadeca-1,18-dien-4-yl] acetate.
| Compound Name | [(1Z,4R,7R,9R,10R,15R,16R)-10,16-diacetyloxy-2-benzyl-1-chloro-7,9,15-trimethylnonadeca-1,18-dien-4-yl] acetate |
|---|---|
| PubChem CID | 162654415 |
| Molecular Formula | C35H53ClO6 |
| Molecular Weight | 605.26 g/mol |
| Exact Mass | 604.35 |
| IUPAC Name | [(1Z,4R,7R,9R,10R,15R,16R)-10,16-diacetyloxy-2-benzyl-1-chloro-7,9,15-trimethylnonadeca-1,18-dien-4-yl] acetate |
| SMILES | C=CC[C@@H](OC(C)=O)[C@H](C)CCCC[C@@H](OC(C)=O)[C@H](C)C[C@H](C)CC[C@H](C/C(=C\Cl)Cc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C35H53ClO6/c1-8-14-34(41-29(6)38)26(3)15-12-13-18-35(42-30(7)39)27(4)21-25(2)19-20-33(40-28(5)37)23-32(24-36)22-31-16-10-9-11-17-31/h8-11,16-17,24-27,33-35H,1,12-15,18-23H2,2-7H3/b32-24-/t25-,26-,27-,33-,34-,35-/m1/s1 |
| InChIKey | PQSOJQDFSXVSEN-YYBDOQICSA-N |
| XLogP | 8.75 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.26 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|