C15H20N2O2 — CID 162654463
(1R,9S,11R,13E)-1-amino-13-(2-hydroxyethylidene)-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3-dien-5-one (PubChem CID 162654463) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is (1R,9S,11R,13E)-1-amino-13-(2-hydroxyethylidene)-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3-dien-5-one.
| Compound Name | (1R,9S,11R,13E)-1-amino-13-(2-hydroxyethylidene)-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3-dien-5-one |
|---|---|
| PubChem CID | 162654463 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (1R,9S,11R,13E)-1-amino-13-(2-hydroxyethylidene)-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3-dien-5-one |
| SMILES | C[C@@H]1C[C@H]2Cc3[nH]c(=O)ccc3[C@@](N)(C1)/C2=C/CO |
| InChI | InChI=1S/C15H20N2O2/c1-9-6-10-7-13-12(2-3-14(19)17-13)15(16,8-9)11(10)4-5-18/h2-4,9-10,18H,5-8,16H2,1H3,(H,17,19)/b11-4+/t9-,10+,15-/m1/s1 |
| InChIKey | PYKYIMCTZCJSJP-QDXUNGBRSA-N |
| XLogP | 1.05 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|