C15H17NO2 — CID 162654558
ethyl (2E,4E,6E,8E)-9-(1H-pyrrol-2-yl)nona-2,4,6,8-tetraenoate (PubChem CID 162654558) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8E)-9-(1H-pyrrol-2-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | ethyl (2E,4E,6E,8E)-9-(1H-pyrrol-2-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 162654558 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | ethyl (2E,4E,6E,8E)-9-(1H-pyrrol-2-yl)nona-2,4,6,8-tetraenoate |
| SMILES | CCOC(=O)/C=C/C=C/C=C/C=C/c1ccc[nH]1 |
| InChI | InChI=1S/C15H17NO2/c1-2-18-15(17)12-8-6-4-3-5-7-10-14-11-9-13-16-14/h3-13,16H,2H2,1H3/b5-3+,6-4+,10-7+,12-8+ |
| InChIKey | WXNGQSHUUDDXCO-BRUOKPNFSA-N |
| XLogP | 3.26 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|