C20H18O3 — CID 162654651
(3aR,9bR)-6-methyl-3-methylidene-9-phenyl-4,5,7,9b-tetrahydro-3aH-azuleno[4,5-b]furan-2,8-dione (PubChem CID 162654651) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is (3aR,9bR)-6-methyl-3-methylidene-9-phenyl-4,5,7,9b-tetrahydro-3aH-azuleno[4,5-b]furan-2,8-dione.
| Compound Name | (3aR,9bR)-6-methyl-3-methylidene-9-phenyl-4,5,7,9b-tetrahydro-3aH-azuleno[4,5-b]furan-2,8-dione |
|---|---|
| PubChem CID | 162654651 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (3aR,9bR)-6-methyl-3-methylidene-9-phenyl-4,5,7,9b-tetrahydro-3aH-azuleno[4,5-b]furan-2,8-dione |
| SMILES | C=C1C(=O)O[C@H]2C3=C(c4ccccc4)C(=O)CC3=C(C)CC[C@H]12 |
| InChI | InChI=1S/C20H18O3/c1-11-8-9-14-12(2)20(22)23-19(14)18-15(11)10-16(21)17(18)13-6-4-3-5-7-13/h3-7,14,19H,2,8-10H2,1H3/t14-,19-/m1/s1 |
| InChIKey | VNKGOMOMHIVOKP-AUUYWEPGSA-N |
| XLogP | 3.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|