C18H28O5 — CID 162654712
(3E,5R,6E,8S,9E,13S,14R)-5-hydroxy-9-(hydroxymethyl)-8-methoxy-5,13,14-trimethyl-1-oxacyclotetradeca-3,6,9-trien-2-one (PubChem CID 162654712) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is (3E,5R,6E,8S,9E,13S,14R)-5-hydroxy-9-(hydroxymethyl)-8-methoxy-5,13,14-trimethyl-1-oxacyclotetradeca-3,6,9-trien-2-one.
| Compound Name | (3E,5R,6E,8S,9E,13S,14R)-5-hydroxy-9-(hydroxymethyl)-8-methoxy-5,13,14-trimethyl-1-oxacyclotetradeca-3,6,9-trien-2-one |
|---|---|
| PubChem CID | 162654712 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (3E,5R,6E,8S,9E,13S,14R)-5-hydroxy-9-(hydroxymethyl)-8-methoxy-5,13,14-trimethyl-1-oxacyclotetradeca-3,6,9-trien-2-one |
| SMILES | CO[C@H]1/C=C/[C@@](C)(O)/C=C/C(=O)O[C@H](C)[C@@H](C)CC/C=C/1CO |
| InChI | InChI=1S/C18H28O5/c1-13-6-5-7-15(12-19)16(22-4)8-10-18(3,21)11-9-17(20)23-14(13)2/h7-11,13-14,16,19,21H,5-6,12H2,1-4H3/b10-8+,11-9+,15-7+/t13-,14+,16-,18+/m0/s1 |
| InChIKey | GWVYOWBVTVOJQJ-ZIKWLIONSA-N |
| XLogP | 2.15 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|