C25H24F4N4O2 — CID 162654874
1-[6-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]pyrimidin-4-yl]-N-(4-hydroxybutyl)-2,3-dihydroindole-4-carboxamide (PubChem CID 162654874) has the molecular formula C25H24F4N4O2 and a molecular weight of 488.49 g/mol. Its IUPAC name is 1-[6-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]pyrimidin-4-yl]-N-(4-hydroxybutyl)-2,3-dihydroindole-4-carboxamide.
| Compound Name | 1-[6-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]pyrimidin-4-yl]-N-(4-hydroxybutyl)-2,3-dihydroindole-4-carboxamide |
|---|---|
| PubChem CID | 162654874 |
| Molecular Formula | C25H24F4N4O2 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 1-[6-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]pyrimidin-4-yl]-N-(4-hydroxybutyl)-2,3-dihydroindole-4-carboxamide |
| SMILES | O=C(NCCCCO)c1cccc2c1CCN2c1cc(Cc2cc(F)cc(C(F)(F)F)c2)ncn1 |
| InChI | InChI=1S/C25H24F4N4O2/c26-18-11-16(10-17(13-18)25(27,28)29)12-19-14-23(32-15-31-19)33-8-6-20-21(4-3-5-22(20)33)24(35)30-7-1-2-9-34/h3-5,10-11,13-15,34H,1-2,6-9,12H2,(H,30,35) |
| InChIKey | SCZSOLFNVLQXMA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|