C25H24N4O3 — CID 162655292
2-amino-10-[4-(2-methoxyphenyl)piperazine-1-carbonyl]acridin-9-one (PubChem CID 162655292) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-amino-10-[4-(2-methoxyphenyl)piperazine-1-carbonyl]acridin-9-one.
| Compound Name | 2-amino-10-[4-(2-methoxyphenyl)piperazine-1-carbonyl]acridin-9-one |
|---|---|
| PubChem CID | 162655292 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-amino-10-[4-(2-methoxyphenyl)piperazine-1-carbonyl]acridin-9-one |
| SMILES | COc1ccccc1N1CCN(C(=O)n2c3ccccc3c(=O)c3cc(N)ccc32)CC1 |
| InChI | InChI=1S/C25H24N4O3/c1-32-23-9-5-4-8-22(23)27-12-14-28(15-13-27)25(31)29-20-7-3-2-6-18(20)24(30)19-16-17(26)10-11-21(19)29/h2-11,16H,12-15,26H2,1H3 |
| InChIKey | VCBVPWKOJDILQZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 80.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|