C31H48N4O3 — CID 162655356
(6E,11S,14S)-9-(3-methylbutyl)-11-(2-methylpropyl)-4-(3-phenylpropyl)-1,4,9,12-tetrazabicyclo[12.3.0]heptadec-6-ene-3,10,13-trione (PubChem CID 162655356) has the molecular formula C31H48N4O3 and a molecular weight of 524.75 g/mol. Its IUPAC name is (6E,11S,14S)-9-(3-methylbutyl)-11-(2-methylpropyl)-4-(3-phenylpropyl)-1,4,9,12-tetrazabicyclo[12.3.0]heptadec-6-ene-3,10,13-trione.
| Compound Name | (6E,11S,14S)-9-(3-methylbutyl)-11-(2-methylpropyl)-4-(3-phenylpropyl)-1,4,9,12-tetrazabicyclo[12.3.0]heptadec-6-ene-3,10,13-trione |
|---|---|
| PubChem CID | 162655356 |
| Molecular Formula | C31H48N4O3 |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.37 |
| IUPAC Name | (6E,11S,14S)-9-(3-methylbutyl)-11-(2-methylpropyl)-4-(3-phenylpropyl)-1,4,9,12-tetrazabicyclo[12.3.0]heptadec-6-ene-3,10,13-trione |
| SMILES | CC(C)CCN1C/C=C/CN(CCCc2ccccc2)C(=O)CN2CCC[C@H]2C(=O)N[C@@H](CC(C)C)C1=O |
| InChI | InChI=1S/C31H48N4O3/c1-24(2)16-21-34-18-9-8-17-33(19-10-14-26-12-6-5-7-13-26)29(36)23-35-20-11-15-28(35)30(37)32-27(31(34)38)22-25(3)4/h5-9,12-13,24-25,27-28H,10-11,14-23H2,1-4H3,(H,32,37)/b9-8+/t27-,28-/m0/s1 |
| InChIKey | YAEVQSWRLOKZQK-MGCNUOKKSA-N |
| XLogP | 3.89 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|