C27H32BBrF2I2N2O — CID 162655383
8-[4-(8-bromooctoxy)phenyl]-2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 162655383) has the molecular formula C27H32BBrF2I2N2O and a molecular weight of 783.09 g/mol. Its IUPAC name is 8-[4-(8-bromooctoxy)phenyl]-2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 8-[4-(8-bromooctoxy)phenyl]-2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 162655383 |
| Molecular Formula | C27H32BBrF2I2N2O |
| Molecular Weight | 783.09 g/mol |
| Exact Mass | 781.98 |
| IUPAC Name | 8-[4-(8-bromooctoxy)phenyl]-2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=C(I)C(C)=[N+]2C1=C(c1ccc(OCCCCCCCCBr)cc1)c1c(C)c(I)c(C)n1[B-]2(F)F |
| InChI | InChI=1S/C27H32BBrF2I2N2O/c1-17-24(32)19(3)34-26(17)23(27-18(2)25(33)20(4)35(27)28(34,30)31)21-11-13-22(14-12-21)36-16-10-8-6-5-7-9-15-29/h11-14H,5-10,15-16H2,1-4H3 |
| InChIKey | SXBUKJIGQSNPQP-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 17.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.09 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|