C14H18O2 — CID 162655447
(5S)-5-[(1E,3E,5E,7E)-deca-1,3,5,7-tetraenyl]oxolan-2-one (PubChem CID 162655447) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (5S)-5-[(1E,3E,5E,7E)-deca-1,3,5,7-tetraenyl]oxolan-2-one.
| Compound Name | (5S)-5-[(1E,3E,5E,7E)-deca-1,3,5,7-tetraenyl]oxolan-2-one |
|---|---|
| PubChem CID | 162655447 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (5S)-5-[(1E,3E,5E,7E)-deca-1,3,5,7-tetraenyl]oxolan-2-one |
| SMILES | CC/C=C/C=C/C=C/C=C/[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C14H18O2/c1-2-3-4-5-6-7-8-9-10-13-11-12-14(15)16-13/h3-10,13H,2,11-12H2,1H3/b4-3+,6-5+,8-7+,10-9+/t13-/m1/s1 |
| InChIKey | ZJFPHXQKKZTRQE-JPJBAVPRSA-N |
| XLogP | 3.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|