About [1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoroanilino]-1-oxopropan-2-yl] thiophene-2-carboxylate
[1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoroanilino]-1-oxopropan-2-yl] thiophene-2-carboxylate (PubChem CID 162655832) has the molecular formula C25H21FN2O6S
and a molecular weight of 496.52 g/mol. Its IUPAC name is [1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoroanilino]-1-oxopropan-2-yl] thiophene-2-carboxylate.
Molecular Properties
| Compound Name | [1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoroanilino]-1-oxopropan-2-yl] thiophene-2-carboxylate |
| PubChem CID | 162655832 |
| Molecular Formula | C25H21FN2O6S |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | [1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoroanilino]-1-oxopropan-2-yl] thiophene-2-carboxylate |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)C(C)OC(=O)c4cccs4)cc3F)c2cc1OC |
| InChI | InChI=1S/C25H21FN2O6S/c1-14(33-25(30)23-5-4-10-35-23)24(29)28-15-6-7-20(17(26)11-15)34-19-8-9-27-18-13-22(32-3)21(31-2)12-16(18)19/h4-14H,1-3H3,(H,28,29) |
| InChIKey | JCKNMBDRXIOCSS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoroanilino]-1-oxopropan-2-yl] thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoroanilino]-1-oxopropan-2-yl] thiophene-2-carboxylate?
The IUPAC name of [1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoroanilino]-1-oxopropan-2-yl] thiophene-2-carboxylate (CID 162655832) is [1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoroanilino]-1-oxopropan-2-yl] thiophene-2-carboxylate.
What is the SMILES notation for [1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoroanilino]-1-oxopropan-2-yl] thiophene-2-carboxylate?
The canonical SMILES for [1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoroanilino]-1-oxopropan-2-yl] thiophene-2-carboxylate is COc1cc2nccc(Oc3ccc(NC(=O)C(C)OC(=O)c4cccs4)cc3F)c2cc1OC.
What is the InChIKey of [1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoroanilino]-1-oxopropan-2-yl] thiophene-2-carboxylate?
The InChIKey is JCKNMBDRXIOCSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21FN2O6S/c1-14(33-25(30)23-5-4-10-35-23)24(29)28-15-6-7-20(17(26)11-15)34-19-8-9-27-18-13-22(32-3)21(31-2)12-16(18)19/h4-14H,1-3H3,(H,28,29).
What are the key properties of [1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoroanilino]-1-oxopropan-2-yl] thiophene-2-carboxylate?
[1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoroanilino]-1-oxopropan-2-yl] thiophene-2-carboxylate has a molecular weight of 496.52 g/mol, XLogP of 5.43, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoroanilino]-1-oxopropan-2-yl] thiophene-2-carboxylate is sourced from PubChem (CID 162655832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).