C32H26I2O7 — CID 162655879
(6S,6aR,7S,12aR)-7-[(E)-2-(4-hydroxyphenyl)ethenyl]-4,11-diiodo-1,8-dimethoxy-6-phenyl-6,6a,7,12a-tetrahydrochromeno[3,2-c]chromene-3,10-diol (PubChem CID 162655879) has the molecular formula C32H26I2O7 and a molecular weight of 776.36 g/mol. Its IUPAC name is (6S,6aR,7S,12aR)-7-[(E)-2-(4-hydroxyphenyl)ethenyl]-4,11-diiodo-1,8-dimethoxy-6-phenyl-6,6a,7,12a-tetrahydrochromeno[3,2-c]chromene-3,10-diol.
| Compound Name | (6S,6aR,7S,12aR)-7-[(E)-2-(4-hydroxyphenyl)ethenyl]-4,11-diiodo-1,8-dimethoxy-6-phenyl-6,6a,7,12a-tetrahydrochromeno[3,2-c]chromene-3,10-diol |
|---|---|
| PubChem CID | 162655879 |
| Molecular Formula | C32H26I2O7 |
| Molecular Weight | 776.36 g/mol |
| Exact Mass | 775.98 |
| IUPAC Name | (6S,6aR,7S,12aR)-7-[(E)-2-(4-hydroxyphenyl)ethenyl]-4,11-diiodo-1,8-dimethoxy-6-phenyl-6,6a,7,12a-tetrahydrochromeno[3,2-c]chromene-3,10-diol |
| SMILES | COc1cc(O)c(I)c2c1[C@@H](/C=C/c1ccc(O)cc1)[C@@H]1[C@@H](c3ccccc3)Oc3c(I)c(O)cc(OC)c3[C@@H]1O2 |
| InChI | InChI=1S/C32H26I2O7/c1-38-22-14-20(36)27(33)31-24(22)19(13-10-16-8-11-18(35)12-9-16)25-29(17-6-4-3-5-7-17)40-32-26(30(25)41-31)23(39-2)15-21(37)28(32)34/h3-15,19,25,29-30,35-37H,1-2H3/b13-10+/t19-,25-,29-,30-/m1/s1 |
| InChIKey | QBUWRUWXNWNLLJ-CVWGDGNMSA-N |
| XLogP | 7.71 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.36 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|