C18H22ClN5 — CID 162655902
2-N-[4-chloro-3-(2,3,4,7-tetrahydro-1H-azepin-5-yl)phenyl]-4-N,6-dimethylpyrimidine-2,4-diamine (PubChem CID 162655902) has the molecular formula C18H22ClN5 and a molecular weight of 343.86 g/mol. Its IUPAC name is 2-N-[4-chloro-3-(2,3,4,7-tetrahydro-1H-azepin-5-yl)phenyl]-4-N,6-dimethylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-chloro-3-(2,3,4,7-tetrahydro-1H-azepin-5-yl)phenyl]-4-N,6-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 162655902 |
| Molecular Formula | C18H22ClN5 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-N-[4-chloro-3-(2,3,4,7-tetrahydro-1H-azepin-5-yl)phenyl]-4-N,6-dimethylpyrimidine-2,4-diamine |
| SMILES | CNc1cc(C)nc(Nc2ccc(Cl)c(C3=CCNCCC3)c2)n1 |
| InChI | InChI=1S/C18H22ClN5/c1-12-10-17(20-2)24-18(22-12)23-14-5-6-16(19)15(11-14)13-4-3-8-21-9-7-13/h5-7,10-11,21H,3-4,8-9H2,1-2H3,(H2,20,22,23,24) |
| InChIKey | MFOQRJHECLPWDG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |