About 4-(4-methoxyphenyl)-2-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,3-thiazole
4-(4-methoxyphenyl)-2-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,3-thiazole (PubChem CID 162655985) has the molecular formula C25H18N2OS2
and a molecular weight of 426.57 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-2-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,3-thiazole |
| PubChem CID | 162655985 |
| Molecular Formula | C25H18N2OS2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 4-(4-methoxyphenyl)-2-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,3-thiazole |
| SMILES | COc1ccc(-c2csc(-c3cccc(-c4csc(-c5ccccc5)n4)c3)n2)cc1 |
| InChI | InChI=1S/C25H18N2OS2/c1-28-21-12-10-17(11-13-21)22-15-30-25(26-22)20-9-5-8-19(14-20)23-16-29-24(27-23)18-6-3-2-4-7-18/h2-16H,1H3 |
| InChIKey | YPPDGBCPPJTNEM-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-methoxyphenyl)-2-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-2-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,3-thiazole?
The IUPAC name of 4-(4-methoxyphenyl)-2-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,3-thiazole (CID 162655985) is 4-(4-methoxyphenyl)-2-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,3-thiazole.
What is the SMILES notation for 4-(4-methoxyphenyl)-2-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,3-thiazole?
The canonical SMILES for 4-(4-methoxyphenyl)-2-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,3-thiazole is COc1ccc(-c2csc(-c3cccc(-c4csc(-c5ccccc5)n4)c3)n2)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)-2-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,3-thiazole?
The InChIKey is YPPDGBCPPJTNEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18N2OS2/c1-28-21-12-10-17(11-13-21)22-15-30-25(26-22)20-9-5-8-19(14-20)23-16-29-24(27-23)18-6-3-2-4-7-18/h2-16H,1H3.
What are the key properties of 4-(4-methoxyphenyl)-2-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,3-thiazole?
4-(4-methoxyphenyl)-2-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,3-thiazole has a molecular weight of 426.57 g/mol, XLogP of 7.28, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-2-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,3-thiazole is sourced from PubChem (CID 162655985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).