C22H20N4O5 — CID 162656000
(2S)-2-amino-6-[(5-oxopyrido[3,2-a]phenoxazine-10-carbonyl)amino]hexanoic acid (PubChem CID 162656000) has the molecular formula C22H20N4O5 and a molecular weight of 420.43 g/mol. Its IUPAC name is (2S)-2-amino-6-[(5-oxopyrido[3,2-a]phenoxazine-10-carbonyl)amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[(5-oxopyrido[3,2-a]phenoxazine-10-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 162656000 |
| Molecular Formula | C22H20N4O5 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (2S)-2-amino-6-[(5-oxopyrido[3,2-a]phenoxazine-10-carbonyl)amino]hexanoic acid |
| SMILES | N[C@@H](CCCCNC(=O)c1ccc2oc3cc(=O)c4ncccc4c-3nc2c1)C(=O)O |
| InChI | InChI=1S/C22H20N4O5/c23-14(22(29)30)5-1-2-8-25-21(28)12-6-7-17-15(10-12)26-20-13-4-3-9-24-19(13)16(27)11-18(20)31-17/h3-4,6-7,9-11,14H,1-2,5,8,23H2,(H,25,28)(H,29,30)/t14-/m0/s1 |
| InChIKey | LPFNEJYNZDKJIT-AWEZNQCLSA-N |
| XLogP | 2.15 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|