About 2,2-dimethyl-7-phenylmethoxy-3,4-dihydrobenzo[h]chromene-5-carboxylic acid
2,2-dimethyl-7-phenylmethoxy-3,4-dihydrobenzo[h]chromene-5-carboxylic acid (PubChem CID 162656091) has the molecular formula C23H22O4
and a molecular weight of 362.43 g/mol. Its IUPAC name is 2,2-dimethyl-7-phenylmethoxy-3,4-dihydrobenzo[h]chromene-5-carboxylic acid.
Molecular Properties
| Compound Name | 2,2-dimethyl-7-phenylmethoxy-3,4-dihydrobenzo[h]chromene-5-carboxylic acid |
| PubChem CID | 162656091 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2,2-dimethyl-7-phenylmethoxy-3,4-dihydrobenzo[h]chromene-5-carboxylic acid |
| SMILES | CC1(C)CCc2c(C(=O)O)cc3c(OCc4ccccc4)cccc3c2O1 |
| InChI | InChI=1S/C23H22O4/c1-23(2)12-11-17-19(22(24)25)13-18-16(21(17)27-23)9-6-10-20(18)26-14-15-7-4-3-5-8-15/h3-10,13H,11-12,14H2,1-2H3,(H,24,25) |
| InChIKey | SNVVBVWONGWLRC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethyl-7-phenylmethoxy-3,4-dihydrobenzo[h]chromene-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-7-phenylmethoxy-3,4-dihydrobenzo[h]chromene-5-carboxylic acid?
The IUPAC name of 2,2-dimethyl-7-phenylmethoxy-3,4-dihydrobenzo[h]chromene-5-carboxylic acid (CID 162656091) is 2,2-dimethyl-7-phenylmethoxy-3,4-dihydrobenzo[h]chromene-5-carboxylic acid.
What is the SMILES notation for 2,2-dimethyl-7-phenylmethoxy-3,4-dihydrobenzo[h]chromene-5-carboxylic acid?
The canonical SMILES for 2,2-dimethyl-7-phenylmethoxy-3,4-dihydrobenzo[h]chromene-5-carboxylic acid is CC1(C)CCc2c(C(=O)O)cc3c(OCc4ccccc4)cccc3c2O1.
What is the InChIKey of 2,2-dimethyl-7-phenylmethoxy-3,4-dihydrobenzo[h]chromene-5-carboxylic acid?
The InChIKey is SNVVBVWONGWLRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22O4/c1-23(2)12-11-17-19(22(24)25)13-18-16(21(17)27-23)9-6-10-20(18)26-14-15-7-4-3-5-8-15/h3-10,13H,11-12,14H2,1-2H3,(H,24,25).
What are the key properties of 2,2-dimethyl-7-phenylmethoxy-3,4-dihydrobenzo[h]chromene-5-carboxylic acid?
2,2-dimethyl-7-phenylmethoxy-3,4-dihydrobenzo[h]chromene-5-carboxylic acid has a molecular weight of 362.43 g/mol, XLogP of 5.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-7-phenylmethoxy-3,4-dihydrobenzo[h]chromene-5-carboxylic acid is sourced from PubChem (CID 162656091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).