C30H28F2N6O3 — CID 162656125
13,14-difluoro-7-(4-methyl-2-propan-2-yl-3-pyridinyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-17-oxa-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,8,11,13,15-heptaen-6-one (PubChem CID 162656125) has the molecular formula C30H28F2N6O3 and a molecular weight of 558.59 g/mol. Its IUPAC name is 13,14-difluoro-7-(4-methyl-2-propan-2-yl-3-pyridinyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-17-oxa-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,8,11,13,15-heptaen-6-one.
| Compound Name | 13,14-difluoro-7-(4-methyl-2-propan-2-yl-3-pyridinyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-17-oxa-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,8,11,13,15-heptaen-6-one |
|---|---|
| PubChem CID | 162656125 |
| Molecular Formula | C30H28F2N6O3 |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | 13,14-difluoro-7-(4-methyl-2-propan-2-yl-3-pyridinyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-17-oxa-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,8,11,13,15-heptaen-6-one |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n(-c3c(C)ccnc3C(C)C)c3nc4c(cc23)oc2cc(F)c(F)cc24)[C@@H](C)C1 |
| InChI | InChI=1S/C30H28F2N6O3/c1-6-24(39)36-9-10-37(17(5)14-36)28-19-12-23-26(18-11-20(31)21(32)13-22(18)41-23)34-29(19)38(30(40)35-28)27-16(4)7-8-33-25(27)15(2)3/h6-8,11-13,15,17H,1,9-10,14H2,2-5H3/t17-/m0/s1 |
| InChIKey | NEBNDURPVQYCOY-KRWDZBQOSA-N |
| XLogP | 5.01 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|