C23H13ClF4N2O4 — CID 162656148
4-(2-chloro-6-fluorobenzoyl)-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzoxazine-6-carboxamide (PubChem CID 162656148) has the molecular formula C23H13ClF4N2O4 and a molecular weight of 492.81 g/mol. Its IUPAC name is 4-(2-chloro-6-fluorobenzoyl)-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzoxazine-6-carboxamide.
| Compound Name | 4-(2-chloro-6-fluorobenzoyl)-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 162656148 |
| Molecular Formula | C23H13ClF4N2O4 |
| Molecular Weight | 492.81 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | 4-(2-chloro-6-fluorobenzoyl)-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzoxazine-6-carboxamide |
| SMILES | O=C(NCc1c(F)cc(F)cc1F)c1ccc2c(c1)N(C(=O)c1c(F)cccc1Cl)C(=O)CO2 |
| InChI | InChI=1S/C23H13ClF4N2O4/c24-14-2-1-3-15(26)21(14)23(33)30-18-6-11(4-5-19(18)34-10-20(30)31)22(32)29-9-13-16(27)7-12(25)8-17(13)28/h1-8H,9-10H2,(H,29,32) |
| InChIKey | BBJNHGYWBBYLEV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.81 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|