C30H28N6O6 — CID 162656162
N-(2-aminophenyl)-4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butanoylamino]benzamide (PubChem CID 162656162) has the molecular formula C30H28N6O6 and a molecular weight of 568.59 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butanoylamino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butanoylamino]benzamide |
|---|---|
| PubChem CID | 162656162 |
| Molecular Formula | C30H28N6O6 |
| Molecular Weight | 568.59 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | N-(2-aminophenyl)-4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butanoylamino]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(NC(=O)CCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C30H28N6O6/c31-20-6-1-2-7-21(20)34-27(39)17-10-12-18(13-11-17)33-24(37)9-4-16-32-22-8-3-5-19-26(22)30(42)36(29(19)41)23-14-15-25(38)35-28(23)40/h1-3,5-8,10-13,23,32H,4,9,14-16,31H2,(H,33,37)(H,34,39)(H,35,38,40) |
| InChIKey | JDVCZYIRYRWVJK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.59 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|