C33H35N7O6 — CID 162656194
2-[[4-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylamino]benzoyl]amino]-3-(1H-indol-2-yl)propanoic acid (PubChem CID 162656194) has the molecular formula C33H35N7O6 and a molecular weight of 625.69 g/mol. Its IUPAC name is 2-[[4-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylamino]benzoyl]amino]-3-(1H-indol-2-yl)propanoic acid.
| Compound Name | 2-[[4-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylamino]benzoyl]amino]-3-(1H-indol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 162656194 |
| Molecular Formula | C33H35N7O6 |
| Molecular Weight | 625.69 g/mol |
| Exact Mass | 625.26 |
| IUPAC Name | 2-[[4-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylamino]benzoyl]amino]-3-(1H-indol-2-yl)propanoic acid |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(OC)c1OCCNc1ccc(C(=O)NC(Cc2cc3ccccc3[nH]2)C(=O)O)cc1 |
| InChI | InChI=1S/C33H35N7O6/c1-44-27-14-19(13-22-18-37-33(35)40-30(22)34)15-28(45-2)29(27)46-12-11-36-23-9-7-20(8-10-23)31(41)39-26(32(42)43)17-24-16-21-5-3-4-6-25(21)38-24/h3-10,14-16,18,26,36,38H,11-13,17H2,1-2H3,(H,39,41)(H,42,43)(H4,34,35,37,40) |
| InChIKey | UPCNVSHFDYCDFM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 199.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.69 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|