C13H28O9S2 — CID 162656201
(2S,3S,4R)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]heptane-2,3,4-triol;methanesulfonate (PubChem CID 162656201) has the molecular formula C13H28O9S2 and a molecular weight of 392.49 g/mol. Its IUPAC name is (2S,3S,4R)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]heptane-2,3,4-triol;methanesulfonate.
| Compound Name | (2S,3S,4R)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]heptane-2,3,4-triol;methanesulfonate |
|---|---|
| PubChem CID | 162656201 |
| Molecular Formula | C13H28O9S2 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | (2S,3S,4R)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]heptane-2,3,4-triol;methanesulfonate |
| SMILES | CCC[C@@H](O)[C@H](O)[C@H](O)C[S+]1C[C@@H](O)[C@H](O)[C@H]1CO.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H25O6S.CH4O3S/c1-2-3-7(14)11(17)8(15)5-19-6-9(16)12(18)10(19)4-13;1-5(2,3)4/h7-18H,2-6H2,1H3;1H3,(H,2,3,4)/q+1;/p-1/t7-,8-,9-,10-,11+,12+,19?;/m1./s1 |
| InChIKey | UPOIPHOFYCMWIB-OVGMNBLTSA-M |
| XLogP | -3.25 |
| TPSA | 178.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|