C19H28N6S — CID 162656207
1-N,1-N-diethyl-4-N-[(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]pentane-1,4-diamine (PubChem CID 162656207) has the molecular formula C19H28N6S and a molecular weight of 372.54 g/mol. Its IUPAC name is 1-N,1-N-diethyl-4-N-[(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]pentane-1,4-diamine.
| Compound Name | 1-N,1-N-diethyl-4-N-[(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 162656207 |
| Molecular Formula | C19H28N6S |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 1-N,1-N-diethyl-4-N-[(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]pentane-1,4-diamine |
| SMILES | CCN(CC)CCCC(C)NCc1nn2c(-c3ccccc3)nnc2s1 |
| InChI | InChI=1S/C19H28N6S/c1-4-24(5-2)13-9-10-15(3)20-14-17-23-25-18(21-22-19(25)26-17)16-11-7-6-8-12-16/h6-8,11-12,15,20H,4-5,9-10,13-14H2,1-3H3 |
| InChIKey | VKWQTYSHJWGMAZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |