C19H15N5O3 — CID 162656322
2-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-4-(4-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 162656322) has the molecular formula C19H15N5O3 and a molecular weight of 361.36 g/mol. Its IUPAC name is 2-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-4-(4-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-4-(4-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 162656322 |
| Molecular Formula | C19H15N5O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-4-(4-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1ccc(-c2nc(N/N=C/c3ccc(O)cc3)[nH]c(=O)c2C#N)cc1 |
| InChI | InChI=1S/C19H15N5O3/c1-27-15-8-4-13(5-9-15)17-16(10-20)18(26)23-19(22-17)24-21-11-12-2-6-14(25)7-3-12/h2-9,11,25H,1H3,(H2,22,23,24,26)/b21-11+ |
| InChIKey | TYUYQGRNDGGZOA-SRZZPIQSSA-N |
| XLogP | 2.47 |
| TPSA | 123.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|