C27H31NO4S — CID 162656330
4,9-dibutyl-2-(4-methylphenyl)sulfonyl-1,3-dihydrobenzo[f]isoindole-5,8-dione (PubChem CID 162656330) has the molecular formula C27H31NO4S and a molecular weight of 465.62 g/mol. Its IUPAC name is 4,9-dibutyl-2-(4-methylphenyl)sulfonyl-1,3-dihydrobenzo[f]isoindole-5,8-dione.
| Compound Name | 4,9-dibutyl-2-(4-methylphenyl)sulfonyl-1,3-dihydrobenzo[f]isoindole-5,8-dione |
|---|---|
| PubChem CID | 162656330 |
| Molecular Formula | C27H31NO4S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 4,9-dibutyl-2-(4-methylphenyl)sulfonyl-1,3-dihydrobenzo[f]isoindole-5,8-dione |
| SMILES | CCCCc1c2c(c(CCCC)c3c1C(=O)C=CC3=O)CN(S(=O)(=O)c1ccc(C)cc1)C2 |
| InChI | InChI=1S/C27H31NO4S/c1-4-6-8-20-22-16-28(33(31,32)19-12-10-18(3)11-13-19)17-23(22)21(9-7-5-2)27-25(30)15-14-24(29)26(20)27/h10-15H,4-9,16-17H2,1-3H3 |
| InChIKey | ZBXQDKFPKPAZAR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|