C38H35ClN8O2 — CID 162656352
N-[3-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-[4-(4-methylpiperazin-1-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]prop-2-enamide (PubChem CID 162656352) has the molecular formula C38H35ClN8O2 and a molecular weight of 671.21 g/mol. Its IUPAC name is N-[3-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-[4-(4-methylpiperazin-1-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-[4-(4-methylpiperazin-1-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 162656352 |
| Molecular Formula | C38H35ClN8O2 |
| Molecular Weight | 671.21 g/mol |
| Exact Mass | 670.26 |
| IUPAC Name | N-[3-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-[4-(4-methylpiperazin-1-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2c(-c3ccc(N4CCN(C)CC4)cc3)[nH]c3ncnc(Nc4ccc(OCc5ccccn5)c(Cl)c4)c23)c1 |
| InChI | InChI=1S/C38H35ClN8O2/c1-3-33(48)43-27-9-6-7-26(21-27)34-35-37(44-28-12-15-32(31(39)22-28)49-23-29-8-4-5-16-40-29)41-24-42-38(35)45-36(34)25-10-13-30(14-11-25)47-19-17-46(2)18-20-47/h3-16,21-22,24H,1,17-20,23H2,2H3,(H,43,48)(H2,41,42,44,45) |
| InChIKey | MTTICWAYROVIKZ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.21 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|