C9H6F5NO2 — CID 162656572
(Z)-4,4,5,5,5-pentafluoro-1-hydroxy-1-(1H-pyrrol-2-yl)pent-1-en-3-one (PubChem CID 162656572) has the molecular formula C9H6F5NO2 and a molecular weight of 255.14 g/mol. Its IUPAC name is (Z)-4,4,5,5,5-pentafluoro-1-hydroxy-1-(1H-pyrrol-2-yl)pent-1-en-3-one.
| Compound Name | (Z)-4,4,5,5,5-pentafluoro-1-hydroxy-1-(1H-pyrrol-2-yl)pent-1-en-3-one |
|---|---|
| PubChem CID | 162656572 |
| Molecular Formula | C9H6F5NO2 |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | (Z)-4,4,5,5,5-pentafluoro-1-hydroxy-1-(1H-pyrrol-2-yl)pent-1-en-3-one |
| SMILES | O=C(/C=C(\O)c1ccc[nH]1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6F5NO2/c10-8(11,9(12,13)14)7(17)4-6(16)5-2-1-3-15-5/h1-4,15-16H/b6-4- |
| InChIKey | FHSUNWHBLMUKMP-XQRVVYSFSA-N |
| XLogP | 2.68 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|