C29H22O6 — CID 162656615
dimethyl 5,8-dioxo-4,9-diphenyl-1,3-dihydrocyclopenta[b]naphthalene-2,2-dicarboxylate (PubChem CID 162656615) has the molecular formula C29H22O6 and a molecular weight of 466.49 g/mol. Its IUPAC name is dimethyl 5,8-dioxo-4,9-diphenyl-1,3-dihydrocyclopenta[b]naphthalene-2,2-dicarboxylate.
| Compound Name | dimethyl 5,8-dioxo-4,9-diphenyl-1,3-dihydrocyclopenta[b]naphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 162656615 |
| Molecular Formula | C29H22O6 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | dimethyl 5,8-dioxo-4,9-diphenyl-1,3-dihydrocyclopenta[b]naphthalene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2c(c(-c3ccccc3)c3c(c2-c2ccccc2)C(=O)C=CC3=O)C1 |
| InChI | InChI=1S/C29H22O6/c1-34-27(32)29(28(33)35-2)15-19-20(16-29)24(18-11-7-4-8-12-18)26-22(31)14-13-21(30)25(26)23(19)17-9-5-3-6-10-17/h3-14H,15-16H2,1-2H3 |
| InChIKey | JXQDGNCVIZOGRU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|