About 2-oxo-N,5-diphenyl-1,3-oxazole-3-carboxamide
2-oxo-N,5-diphenyl-1,3-oxazole-3-carboxamide (PubChem CID 162656722) has the molecular formula C16H12N2O3
and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-oxo-N,5-diphenyl-1,3-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 2-oxo-N,5-diphenyl-1,3-oxazole-3-carboxamide |
| PubChem CID | 162656722 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-oxo-N,5-diphenyl-1,3-oxazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)n1cc(-c2ccccc2)oc1=O |
| InChI | InChI=1S/C16H12N2O3/c19-15(17-13-9-5-2-6-10-13)18-11-14(21-16(18)20)12-7-3-1-4-8-12/h1-11H,(H,17,19) |
| InChIKey | GIPZFJQFDKMBPV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-oxo-N,5-diphenyl-1,3-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-N,5-diphenyl-1,3-oxazole-3-carboxamide?
The IUPAC name of 2-oxo-N,5-diphenyl-1,3-oxazole-3-carboxamide (CID 162656722) is 2-oxo-N,5-diphenyl-1,3-oxazole-3-carboxamide.
What is the SMILES notation for 2-oxo-N,5-diphenyl-1,3-oxazole-3-carboxamide?
The canonical SMILES for 2-oxo-N,5-diphenyl-1,3-oxazole-3-carboxamide is O=C(Nc1ccccc1)n1cc(-c2ccccc2)oc1=O.
What is the InChIKey of 2-oxo-N,5-diphenyl-1,3-oxazole-3-carboxamide?
The InChIKey is GIPZFJQFDKMBPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O3/c19-15(17-13-9-5-2-6-10-13)18-11-14(21-16(18)20)12-7-3-1-4-8-12/h1-11H,(H,17,19).
What are the key properties of 2-oxo-N,5-diphenyl-1,3-oxazole-3-carboxamide?
2-oxo-N,5-diphenyl-1,3-oxazole-3-carboxamide has a molecular weight of 280.28 g/mol, XLogP of 3.19, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-N,5-diphenyl-1,3-oxazole-3-carboxamide is sourced from PubChem (CID 162656722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).