C16H12N4O — CID 162656796
5-(4-methoxyphenyl)-3,7,8,13-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene (PubChem CID 162656796) has the molecular formula C16H12N4O and a molecular weight of 276.30 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-3,7,8,13-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene.
| Compound Name | 5-(4-methoxyphenyl)-3,7,8,13-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene |
|---|---|
| PubChem CID | 162656796 |
| Molecular Formula | C16H12N4O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 5-(4-methoxyphenyl)-3,7,8,13-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene |
| SMILES | COc1ccc(-c2cnc3c4ncccc4nn3c2)cc1 |
| InChI | InChI=1S/C16H12N4O/c1-21-13-6-4-11(5-7-13)12-9-18-16-15-14(3-2-8-17-15)19-20(16)10-12/h2-10H,1H3 |
| InChIKey | JRZBIXAPMAWODK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |