C22H23NO4 — CID 162656828
2-[anilino-(4-propan-2-ylphenyl)methyl]-3-hydroxy-6-(hydroxymethyl)pyran-4-one (PubChem CID 162656828) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-[anilino-(4-propan-2-ylphenyl)methyl]-3-hydroxy-6-(hydroxymethyl)pyran-4-one.
| Compound Name | 2-[anilino-(4-propan-2-ylphenyl)methyl]-3-hydroxy-6-(hydroxymethyl)pyran-4-one |
|---|---|
| PubChem CID | 162656828 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 2-[anilino-(4-propan-2-ylphenyl)methyl]-3-hydroxy-6-(hydroxymethyl)pyran-4-one |
| SMILES | CC(C)c1ccc(C(Nc2ccccc2)c2oc(CO)cc(=O)c2O)cc1 |
| InChI | InChI=1S/C22H23NO4/c1-14(2)15-8-10-16(11-9-15)20(23-17-6-4-3-5-7-17)22-21(26)19(25)12-18(13-24)27-22/h3-12,14,20,23-24,26H,13H2,1-2H3 |
| InChIKey | NRXIMYYOHAAQDM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |