About 4-butoxypyrido[3,2-d]pyrimidin-2-amine
4-butoxypyrido[3,2-d]pyrimidin-2-amine (PubChem CID 162656916) has the molecular formula C11H14N4O
and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-butoxypyrido[3,2-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-butoxypyrido[3,2-d]pyrimidin-2-amine |
| PubChem CID | 162656916 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-butoxypyrido[3,2-d]pyrimidin-2-amine |
| SMILES | CCCCOc1nc(N)nc2cccnc12 |
| InChI | InChI=1S/C11H14N4O/c1-2-3-7-16-10-9-8(5-4-6-13-9)14-11(12)15-10/h4-6H,2-3,7H2,1H3,(H2,12,14,15) |
| InChIKey | PQYDNRHVFOSPNA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxypyrido[3,2-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxypyrido[3,2-d]pyrimidin-2-amine?
The IUPAC name of 4-butoxypyrido[3,2-d]pyrimidin-2-amine (CID 162656916) is 4-butoxypyrido[3,2-d]pyrimidin-2-amine.
What is the SMILES notation for 4-butoxypyrido[3,2-d]pyrimidin-2-amine?
The canonical SMILES for 4-butoxypyrido[3,2-d]pyrimidin-2-amine is CCCCOc1nc(N)nc2cccnc12.
What is the InChIKey of 4-butoxypyrido[3,2-d]pyrimidin-2-amine?
The InChIKey is PQYDNRHVFOSPNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O/c1-2-3-7-16-10-9-8(5-4-6-13-9)14-11(12)15-10/h4-6H,2-3,7H2,1H3,(H2,12,14,15).
What are the key properties of 4-butoxypyrido[3,2-d]pyrimidin-2-amine?
4-butoxypyrido[3,2-d]pyrimidin-2-amine has a molecular weight of 218.26 g/mol, XLogP of 1.79, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxypyrido[3,2-d]pyrimidin-2-amine is sourced from PubChem (CID 162656916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).