About N-(2,5-dichlorophenyl)-7-methoxy-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine
N-(2,5-dichlorophenyl)-7-methoxy-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine (PubChem CID 162657095) has the molecular formula C19H14Cl2N4O
and a molecular weight of 385.25 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-7-methoxy-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine.
Molecular Properties
| Compound Name | N-(2,5-dichlorophenyl)-7-methoxy-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine |
| PubChem CID | 162657095 |
| Molecular Formula | C19H14Cl2N4O |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | N-(2,5-dichlorophenyl)-7-methoxy-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine |
| SMILES | COc1ccn2c(Nc3cc(Cl)ccc3Cl)c(-c3ccccn3)nc2c1 |
| InChI | InChI=1S/C19H14Cl2N4O/c1-26-13-7-9-25-17(11-13)24-18(15-4-2-3-8-22-15)19(25)23-16-10-12(20)5-6-14(16)21/h2-11,23H,1H3 |
| InChIKey | YSGFBIWBGLCPKQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_65_Db(5)', 'substructure': 'N/A'} |
|---|
Analyze N-(2,5-dichlorophenyl)-7-methoxy-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dichlorophenyl)-7-methoxy-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine?
The IUPAC name of N-(2,5-dichlorophenyl)-7-methoxy-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine (CID 162657095) is N-(2,5-dichlorophenyl)-7-methoxy-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine.
What is the SMILES notation for N-(2,5-dichlorophenyl)-7-methoxy-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine?
The canonical SMILES for N-(2,5-dichlorophenyl)-7-methoxy-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine is COc1ccn2c(Nc3cc(Cl)ccc3Cl)c(-c3ccccn3)nc2c1.
What is the InChIKey of N-(2,5-dichlorophenyl)-7-methoxy-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine?
The InChIKey is YSGFBIWBGLCPKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14Cl2N4O/c1-26-13-7-9-25-17(11-13)24-18(15-4-2-3-8-22-15)19(25)23-16-10-12(20)5-6-14(16)21/h2-11,23H,1H3.
What are the key properties of N-(2,5-dichlorophenyl)-7-methoxy-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine?
N-(2,5-dichlorophenyl)-7-methoxy-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine has a molecular weight of 385.25 g/mol, XLogP of 5.46, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dichlorophenyl)-7-methoxy-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine is sourced from PubChem (CID 162657095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).