About 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole-3-carbonitrile
5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole-3-carbonitrile (PubChem CID 162657318) has the molecular formula C19H17N3S2
and a molecular weight of 351.50 g/mol. Its IUPAC name is 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole-3-carbonitrile.
Molecular Properties
| Compound Name | 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole-3-carbonitrile |
| PubChem CID | 162657318 |
| Molecular Formula | C19H17N3S2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole-3-carbonitrile |
| SMILES | C=C(c1cc(SC)nc(SC)c1)c1ccc2c(c1)c(C#N)cn2C |
| InChI | InChI=1S/C19H17N3S2/c1-12(14-8-18(23-3)21-19(9-14)24-4)13-5-6-17-16(7-13)15(10-20)11-22(17)2/h5-9,11H,1H2,2-4H3 |
| InChIKey | JLTRONHPEGIDHB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole-3-carbonitrile?
The IUPAC name of 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole-3-carbonitrile (CID 162657318) is 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole-3-carbonitrile.
What is the SMILES notation for 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole-3-carbonitrile?
The canonical SMILES for 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole-3-carbonitrile is C=C(c1cc(SC)nc(SC)c1)c1ccc2c(c1)c(C#N)cn2C.
What is the InChIKey of 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole-3-carbonitrile?
The InChIKey is JLTRONHPEGIDHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3S2/c1-12(14-8-18(23-3)21-19(9-14)24-4)13-5-6-17-16(7-13)15(10-20)11-22(17)2/h5-9,11H,1H2,2-4H3.
What are the key properties of 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole-3-carbonitrile?
5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole-3-carbonitrile has a molecular weight of 351.50 g/mol, XLogP of 4.95, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole-3-carbonitrile is sourced from PubChem (CID 162657318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).