C36H16F9N5 — CID 162657394
10-(2-fluoro-4-pyridinyl)-5,15-bis(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin (PubChem CID 162657394) has the molecular formula C36H16F9N5 and a molecular weight of 689.54 g/mol. Its IUPAC name is 10-(2-fluoro-4-pyridinyl)-5,15-bis(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin.
| Compound Name | 10-(2-fluoro-4-pyridinyl)-5,15-bis(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin |
|---|---|
| PubChem CID | 162657394 |
| Molecular Formula | C36H16F9N5 |
| Molecular Weight | 689.54 g/mol |
| Exact Mass | 689.13 |
| IUPAC Name | 10-(2-fluoro-4-pyridinyl)-5,15-bis(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin |
| SMILES | Fc1cc(-c2c3ccc([nH]3)c(-c3c(F)c(F)cc(F)c3F)c3nc(c4ccc([nH]4)c(-c4c(F)c(F)cc(F)c4F)c4ccc2[nH]4)C=C3)ccn1 |
| InChI | InChI=1S/C36H16F9N5/c37-15-12-16(38)34(43)31(33(15)42)29-23-3-1-19(47-23)20-2-4-24(48-20)30(32-35(44)17(39)13-18(40)36(32)45)26-8-6-22(50-26)28(21-5-7-25(29)49-21)14-9-10-46-27(41)11-14/h1-13,47,49-50H/b20-19-,28-21-,28-22-,29-23+,29-25+,30-24+,30-26+ |
| InChIKey | BFGHUHVSMLSPSP-HGLVBMGHSA-N |
| XLogP | 10.34 |
| TPSA | 73.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.54 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|