C32H32N6O6 — CID 162657608
N-(2-aminophenyl)-4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoylamino]benzamide (PubChem CID 162657608) has the molecular formula C32H32N6O6 and a molecular weight of 596.64 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoylamino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoylamino]benzamide |
|---|---|
| PubChem CID | 162657608 |
| Molecular Formula | C32H32N6O6 |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | N-(2-aminophenyl)-4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoylamino]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(NC(=O)CCCCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C32H32N6O6/c33-22-8-3-4-9-23(22)36-29(41)19-12-14-20(15-13-19)35-26(39)11-2-1-5-18-34-24-10-6-7-21-28(24)32(44)38(31(21)43)25-16-17-27(40)37-30(25)42/h3-4,6-10,12-15,25,34H,1-2,5,11,16-18,33H2,(H,35,39)(H,36,41)(H,37,40,42) |
| InChIKey | PZFYWPRLDKIIHM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|