C21H13NO4 — CID 162657749
17-phenyl-14-oxa-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),3,5,7,12(16)-pentaene-2,9,15-trione (PubChem CID 162657749) has the molecular formula C21H13NO4 and a molecular weight of 343.34 g/mol. Its IUPAC name is 17-phenyl-14-oxa-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),3,5,7,12(16)-pentaene-2,9,15-trione.
| Compound Name | 17-phenyl-14-oxa-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),3,5,7,12(16)-pentaene-2,9,15-trione |
|---|---|
| PubChem CID | 162657749 |
| Molecular Formula | C21H13NO4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 17-phenyl-14-oxa-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),3,5,7,12(16)-pentaene-2,9,15-trione |
| SMILES | O=C1OCC2=C1C(c1ccccc1)C1=C(N2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H13NO4/c23-19-12-8-4-5-9-13(12)20(24)18-17(19)15(11-6-2-1-3-7-11)16-14(22-18)10-26-21(16)25/h1-9,15,22H,10H2 |
| InChIKey | WTJIHCZHEHMLES-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|