C24H22N8O3 — CID 162657755
ethyl (2R)-2-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]amino]-3-(1H-indol-2-yl)propanoate (PubChem CID 162657755) has the molecular formula C24H22N8O3 and a molecular weight of 470.49 g/mol. Its IUPAC name is ethyl (2R)-2-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]amino]-3-(1H-indol-2-yl)propanoate.
| Compound Name | ethyl (2R)-2-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]amino]-3-(1H-indol-2-yl)propanoate |
|---|---|
| PubChem CID | 162657755 |
| Molecular Formula | C24H22N8O3 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | ethyl (2R)-2-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]amino]-3-(1H-indol-2-yl)propanoate |
| SMILES | CCOC(=O)[C@@H](Cc1cc2ccccc2[nH]1)Nc1nc2nn(C)cc2c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C24H22N8O3/c1-3-34-23(33)18(12-15-11-14-7-4-5-8-17(14)25-15)26-24-28-20-16(13-31(2)29-20)22-27-21(30-32(22)24)19-9-6-10-35-19/h4-11,13,18,25H,3,12H2,1-2H3,(H,26,28,29)/t18-/m1/s1 |
| InChIKey | ABTMQITXLXSPOI-GOSISDBHSA-N |
| XLogP | 3.34 |
| TPSA | 128.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |