About N,N-bis[(2-methoxy-5,7-dimethylquinolin-3-yl)methyl]-1-pyridin-2-ylmethanamine
N,N-bis[(2-methoxy-5,7-dimethylquinolin-3-yl)methyl]-1-pyridin-2-ylmethanamine (PubChem CID 162657760) has the molecular formula C32H34N4O2
and a molecular weight of 506.65 g/mol. Its IUPAC name is N,N-bis[(2-methoxy-5,7-dimethylquinolin-3-yl)methyl]-1-pyridin-2-ylmethanamine.
Molecular Properties
| Compound Name | N,N-bis[(2-methoxy-5,7-dimethylquinolin-3-yl)methyl]-1-pyridin-2-ylmethanamine |
| PubChem CID | 162657760 |
| Molecular Formula | C32H34N4O2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | N,N-bis[(2-methoxy-5,7-dimethylquinolin-3-yl)methyl]-1-pyridin-2-ylmethanamine |
| SMILES | COc1nc2cc(C)cc(C)c2cc1CN(Cc1ccccn1)Cc1cc2c(C)cc(C)cc2nc1OC |
| InChI | InChI=1S/C32H34N4O2/c1-20-11-22(3)27-15-24(31(37-5)34-29(27)13-20)17-36(19-26-9-7-8-10-33-26)18-25-16-28-23(4)12-21(2)14-30(28)35-32(25)38-6/h7-16H,17-19H2,1-6H3 |
| InChIKey | SIFHKPMMKVVQFJ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N,N-bis[(2-methoxy-5,7-dimethylquinolin-3-yl)methyl]-1-pyridin-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis[(2-methoxy-5,7-dimethylquinolin-3-yl)methyl]-1-pyridin-2-ylmethanamine?
The IUPAC name of N,N-bis[(2-methoxy-5,7-dimethylquinolin-3-yl)methyl]-1-pyridin-2-ylmethanamine (CID 162657760) is N,N-bis[(2-methoxy-5,7-dimethylquinolin-3-yl)methyl]-1-pyridin-2-ylmethanamine.
What is the SMILES notation for N,N-bis[(2-methoxy-5,7-dimethylquinolin-3-yl)methyl]-1-pyridin-2-ylmethanamine?
The canonical SMILES for N,N-bis[(2-methoxy-5,7-dimethylquinolin-3-yl)methyl]-1-pyridin-2-ylmethanamine is COc1nc2cc(C)cc(C)c2cc1CN(Cc1ccccn1)Cc1cc2c(C)cc(C)cc2nc1OC.
What is the InChIKey of N,N-bis[(2-methoxy-5,7-dimethylquinolin-3-yl)methyl]-1-pyridin-2-ylmethanamine?
The InChIKey is SIFHKPMMKVVQFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H34N4O2/c1-20-11-22(3)27-15-24(31(37-5)34-29(27)13-20)17-36(19-26-9-7-8-10-33-26)18-25-16-28-23(4)12-21(2)14-30(28)35-32(25)38-6/h7-16H,17-19H2,1-6H3.
What are the key properties of N,N-bis[(2-methoxy-5,7-dimethylquinolin-3-yl)methyl]-1-pyridin-2-ylmethanamine?
N,N-bis[(2-methoxy-5,7-dimethylquinolin-3-yl)methyl]-1-pyridin-2-ylmethanamine has a molecular weight of 506.65 g/mol, XLogP of 6.63, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis[(2-methoxy-5,7-dimethylquinolin-3-yl)methyl]-1-pyridin-2-ylmethanamine is sourced from PubChem (CID 162657760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).