C20H20BrN3O5S — CID 162657772
ethyl 5-(3-bromo-4,5-dimethoxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxylate (PubChem CID 162657772) has the molecular formula C20H20BrN3O5S and a molecular weight of 494.37 g/mol. Its IUPAC name is ethyl 5-(3-bromo-4,5-dimethoxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxylate.
| Compound Name | ethyl 5-(3-bromo-4,5-dimethoxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxylate |
|---|---|
| PubChem CID | 162657772 |
| Molecular Formula | C20H20BrN3O5S |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | ethyl 5-(3-bromo-4,5-dimethoxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxylate |
| SMILES | CCOC(=O)N1CCc2c(sc3nc(-c4cc(Br)c(OC)c(OC)c4)[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C20H20BrN3O5S/c1-4-29-20(26)24-6-5-11-14(9-24)30-19-15(11)18(25)22-17(23-19)10-7-12(21)16(28-3)13(8-10)27-2/h7-8H,4-6,9H2,1-3H3,(H,22,23,25) |
| InChIKey | DTDPRYPGXLQTLC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |