C31H46N2O5S — CID 162657976
[(1S,2R,3S,4S,6R,7S,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-butoxy-6-methylpyrimidin-2-yl)sulfanylacetate (PubChem CID 162657976) has the molecular formula C31H46N2O5S and a molecular weight of 558.79 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7S,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-butoxy-6-methylpyrimidin-2-yl)sulfanylacetate.
| Compound Name | [(1S,2R,3S,4S,6R,7S,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-butoxy-6-methylpyrimidin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 162657976 |
| Molecular Formula | C31H46N2O5S |
| Molecular Weight | 558.79 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7S,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-butoxy-6-methylpyrimidin-2-yl)sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSc2nc(C)cc(OCCCC)n2)[C@@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C31H46N2O5S/c1-8-10-15-37-24-16-20(4)32-28(33-24)39-18-25(35)38-23-17-29(6,9-2)27(36)21(5)31-13-11-19(3)30(23,7)26(31)22(34)12-14-31/h9,16,19,21,23,26-27,36H,2,8,10-15,17-18H2,1,3-7H3/t19-,21+,23-,26+,27+,29-,30-,31+/m1/s1 |
| InChIKey | NYRPONDGKAOWKB-RQLDQUHFSA-N |
| XLogP | 5.96 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.79 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|