About 11-[(2-bromophenyl)methyl]-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole
11-[(2-bromophenyl)methyl]-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole (PubChem CID 162658065) has the molecular formula C25H22BrNO2
and a molecular weight of 448.36 g/mol. Its IUPAC name is 11-[(2-bromophenyl)methyl]-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole.
Molecular Properties
| Compound Name | 11-[(2-bromophenyl)methyl]-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole |
| PubChem CID | 162658065 |
| Molecular Formula | C25H22BrNO2 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 11-[(2-bromophenyl)methyl]-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole |
| SMILES | COc1ccc2c(c1)c1ccc3c(c1n2Cc1ccccc1Br)C=CC(C)(C)O3 |
| InChI | InChI=1S/C25H22BrNO2/c1-25(2)13-12-19-23(29-25)11-9-18-20-14-17(28-3)8-10-22(20)27(24(18)19)15-16-6-4-5-7-21(16)26/h4-14H,15H2,1-3H3 |
| InChIKey | XHZXJQULDVYLLH-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 11-[(2-bromophenyl)methyl]-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-[(2-bromophenyl)methyl]-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole?
The IUPAC name of 11-[(2-bromophenyl)methyl]-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole (CID 162658065) is 11-[(2-bromophenyl)methyl]-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole.
What is the SMILES notation for 11-[(2-bromophenyl)methyl]-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole?
The canonical SMILES for 11-[(2-bromophenyl)methyl]-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole is COc1ccc2c(c1)c1ccc3c(c1n2Cc1ccccc1Br)C=CC(C)(C)O3.
What is the InChIKey of 11-[(2-bromophenyl)methyl]-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole?
The InChIKey is XHZXJQULDVYLLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22BrNO2/c1-25(2)13-12-19-23(29-25)11-9-18-20-14-17(28-3)8-10-22(20)27(24(18)19)15-16-6-4-5-7-21(16)26/h4-14H,15H2,1-3H3.
What are the key properties of 11-[(2-bromophenyl)methyl]-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole?
11-[(2-bromophenyl)methyl]-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole has a molecular weight of 448.36 g/mol, XLogP of 6.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-[(2-bromophenyl)methyl]-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole is sourced from PubChem (CID 162658065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).