C16H20O2 — CID 162658103
(3S,8E)-hexadeca-1,8,15-trien-4,6-diyne-3,10-diol (PubChem CID 162658103) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (3S,8E)-hexadeca-1,8,15-trien-4,6-diyne-3,10-diol.
| Compound Name | (3S,8E)-hexadeca-1,8,15-trien-4,6-diyne-3,10-diol |
|---|---|
| PubChem CID | 162658103 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (3S,8E)-hexadeca-1,8,15-trien-4,6-diyne-3,10-diol |
| SMILES | C=CCCCCC(O)/C=C/C#CC#C[C@@H](O)C=C |
| InChI | InChI=1S/C16H20O2/c1-3-5-6-9-13-16(18)14-11-8-7-10-12-15(17)4-2/h3-4,11,14-18H,1-2,5-6,9,13H2/b14-11+/t15-,16?/m0/s1 |
| InChIKey | MMXHCQJQYXZWGP-ANCIEEHGSA-N |
| XLogP | 2.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|