C22H20F3N3OS — CID 162658119
N-[4-(1,3-thiazol-4-yl)phenyl]-1-[(3,4,5-trifluorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 162658119) has the molecular formula C22H20F3N3OS and a molecular weight of 431.48 g/mol. Its IUPAC name is N-[4-(1,3-thiazol-4-yl)phenyl]-1-[(3,4,5-trifluorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-[4-(1,3-thiazol-4-yl)phenyl]-1-[(3,4,5-trifluorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 162658119 |
| Molecular Formula | C22H20F3N3OS |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N-[4-(1,3-thiazol-4-yl)phenyl]-1-[(3,4,5-trifluorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(-c2cscn2)cc1)C1CCCN(Cc2cc(F)c(F)c(F)c2)C1 |
| InChI | InChI=1S/C22H20F3N3OS/c23-18-8-14(9-19(24)21(18)25)10-28-7-1-2-16(11-28)22(29)27-17-5-3-15(4-6-17)20-12-30-13-26-20/h3-6,8-9,12-13,16H,1-2,7,10-11H2,(H,27,29) |
| InChIKey | DGSMGWKJQQHBAZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|