C27H34N6O6 — CID 162658195
2-[[4-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylamino]benzoyl]amino]-3-methylbutanoic acid (PubChem CID 162658195) has the molecular formula C27H34N6O6 and a molecular weight of 538.61 g/mol. Its IUPAC name is 2-[[4-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylamino]benzoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[4-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylamino]benzoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 162658195 |
| Molecular Formula | C27H34N6O6 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | 2-[[4-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylamino]benzoyl]amino]-3-methylbutanoic acid |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(OC)c1OCCNc1ccc(C(=O)NC(C(=O)O)C(C)C)cc1 |
| InChI | InChI=1S/C27H34N6O6/c1-15(2)22(26(35)36)32-25(34)17-5-7-19(8-6-17)30-9-10-39-23-20(37-3)12-16(13-21(23)38-4)11-18-14-31-27(29)33-24(18)28/h5-8,12-15,22,30H,9-11H2,1-4H3,(H,32,34)(H,35,36)(H4,28,29,31,33) |
| InChIKey | RTTYEJCBYSIJNU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 183.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|