C16H20N8O — CID 162658201
5-(6-morpholin-4-yl-9-propan-2-ylpurin-2-yl)pyrimidin-2-amine (PubChem CID 162658201) has the molecular formula C16H20N8O and a molecular weight of 340.39 g/mol. Its IUPAC name is 5-(6-morpholin-4-yl-9-propan-2-ylpurin-2-yl)pyrimidin-2-amine.
| Compound Name | 5-(6-morpholin-4-yl-9-propan-2-ylpurin-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 162658201 |
| Molecular Formula | C16H20N8O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 5-(6-morpholin-4-yl-9-propan-2-ylpurin-2-yl)pyrimidin-2-amine |
| SMILES | CC(C)n1cnc2c(N3CCOCC3)nc(-c3cnc(N)nc3)nc21 |
| InChI | InChI=1S/C16H20N8O/c1-10(2)24-9-20-12-14(23-3-5-25-6-4-23)21-13(22-15(12)24)11-7-18-16(17)19-8-11/h7-10H,3-6H2,1-2H3,(H2,17,18,19) |
| InChIKey | IESJNOLDTXKVKQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |