C24H23NO3 — CID 162658215
5'-methoxy-1',3',3'-trimethylspiro[benzo[f]chromene-3,2'-indole]-9-ol (PubChem CID 162658215) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is 5'-methoxy-1',3',3'-trimethylspiro[benzo[f]chromene-3,2'-indole]-9-ol.
| Compound Name | 5'-methoxy-1',3',3'-trimethylspiro[benzo[f]chromene-3,2'-indole]-9-ol |
|---|---|
| PubChem CID | 162658215 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 5'-methoxy-1',3',3'-trimethylspiro[benzo[f]chromene-3,2'-indole]-9-ol |
| SMILES | COc1ccc2c(c1)C(C)(C)C1(C=Cc3c(ccc4ccc(O)cc34)O1)N2C |
| InChI | InChI=1S/C24H23NO3/c1-23(2)20-14-17(27-4)8-9-21(20)25(3)24(23)12-11-18-19-13-16(26)7-5-15(19)6-10-22(18)28-24/h5-14,26H,1-4H3 |
| InChIKey | GVSQKBSMNSSQNL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|