C19H17ClN2O3S — CID 162658338
(5Z)-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-[(1S,2S)-2-hydroxycyclopentyl]imino-1,3-thiazolidin-4-one (PubChem CID 162658338) has the molecular formula C19H17ClN2O3S and a molecular weight of 388.88 g/mol. Its IUPAC name is (5Z)-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-[(1S,2S)-2-hydroxycyclopentyl]imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-[(1S,2S)-2-hydroxycyclopentyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 162658338 |
| Molecular Formula | C19H17ClN2O3S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | (5Z)-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-[(1S,2S)-2-hydroxycyclopentyl]imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\[C@H]2CCC[C@@H]2O)S/C1=C\c1ccc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C19H17ClN2O3S/c20-12-4-1-3-11(9-12)16-8-7-13(25-16)10-17-18(24)22-19(26-17)21-14-5-2-6-15(14)23/h1,3-4,7-10,14-15,23H,2,5-6H2,(H,21,22,24)/b17-10-/t14-,15-/m0/s1 |
| InChIKey | KORLHUPICCNRMF-MFUVWIPLSA-N |
| XLogP | 4.07 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|