C26H25ClN8 — CID 162658362
6-chloro-N-[4-[4-(pyrazol-1-ylmethyl)triazol-1-yl]butyl]-2-[(E)-2-pyridin-4-ylethenyl]quinolin-4-amine (PubChem CID 162658362) has the molecular formula C26H25ClN8 and a molecular weight of 485.00 g/mol. Its IUPAC name is 6-chloro-N-[4-[4-(pyrazol-1-ylmethyl)triazol-1-yl]butyl]-2-[(E)-2-pyridin-4-ylethenyl]quinolin-4-amine.
| Compound Name | 6-chloro-N-[4-[4-(pyrazol-1-ylmethyl)triazol-1-yl]butyl]-2-[(E)-2-pyridin-4-ylethenyl]quinolin-4-amine |
|---|---|
| PubChem CID | 162658362 |
| Molecular Formula | C26H25ClN8 |
| Molecular Weight | 485.00 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 6-chloro-N-[4-[4-(pyrazol-1-ylmethyl)triazol-1-yl]butyl]-2-[(E)-2-pyridin-4-ylethenyl]quinolin-4-amine |
| SMILES | Clc1ccc2nc(/C=C/c3ccncc3)cc(NCCCCn3cc(Cn4cccn4)nn3)c2c1 |
| InChI | InChI=1S/C26H25ClN8/c27-21-5-7-25-24(16-21)26(17-22(31-25)6-4-20-8-12-28-13-9-20)29-10-1-2-14-35-19-23(32-33-35)18-34-15-3-11-30-34/h3-9,11-13,15-17,19H,1-2,10,14,18H2,(H,29,31)/b6-4+ |
| InChIKey | CFZAFKKHEAZBEK-GQCTYLIASA-N |
| XLogP | 5.18 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.00 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|