C18H26O4 — CID 162658423
(2R,4aR,7R,8aR)-2-(4-hydroxy-3-methoxyphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-ol (PubChem CID 162658423) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (2R,4aR,7R,8aR)-2-(4-hydroxy-3-methoxyphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-ol.
| Compound Name | (2R,4aR,7R,8aR)-2-(4-hydroxy-3-methoxyphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-ol |
|---|---|
| PubChem CID | 162658423 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (2R,4aR,7R,8aR)-2-(4-hydroxy-3-methoxyphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-ol |
| SMILES | COc1cc([C@H]2CC(C)(O)[C@@H]3CC[C@@H](C)C[C@H]3O2)ccc1O |
| InChI | InChI=1S/C18H26O4/c1-11-4-6-13-15(8-11)22-17(10-18(13,2)20)12-5-7-14(19)16(9-12)21-3/h5,7,9,11,13,15,17,19-20H,4,6,8,10H2,1-3H3/t11-,13-,15-,17-,18?/m1/s1 |
| InChIKey | AHHHNIACCMXMGX-JLNAFUKRSA-N |
| XLogP | 3.42 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |